ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
17430-82-9 oleic acid, compound with dodecylamine (1:1) |
|
Nazwa produktu: | oleic acid, compound with dodecylamine (1:1) |
Angielska nazwa | oleic acid, compound with dodecylamine (1:1);Oleic acid, compound with dodecylamine (1:1);dodecan-1-amine; (Z)-octadec-9-enoic acid |
MF | C30H61NO2 |
Masie cząsteczkowej | 467.8108 |
InChI | InChI=1/C18H34O2.C12H27N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-13H2,1H3/b10-9-; |
Nr CAS | 17430-82-9 |
EINECS | 241-456-2 |
Struktury molekularnej | ![]() |
Temperatura wrzenia | 555.6°C at 760 mmHg |
Temperatura zapłonu | 289.8°C |
Ciśnienie pary | 8.35E-14mmHg at 25°C |
MSDS |