ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1643-15-8 (m-Tolyloxy)-acetic acid |
|
Nazwa produktu: | (m-Tolyloxy)-acetic acid |
Angielska nazwa | (m-Tolyloxy)-acetic acid;3-Methylphenoxyacetic acid;(3-methylphenoxy)acetic acid;(3-methylphenoxy)acetate |
MF | C9H9O3 |
Masie cząsteczkowej | 165.1665 |
InChI | InChI=1/C9H10O3/c1-7-3-2-4-8(5-7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
Nr CAS | 1643-15-8 |
EINECS | 216-698-7 |
Struktury molekularnej | |
Temperatura wrzenia | 300°C at 760 mmHg |
Temperatura zapłonu | 121.4°C |
Ciśnienie pary | 0.000512mmHg at 25°C |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |