ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Triethyleneglycoldiacetate |
|
Nazwa produktu: | Triethyleneglycoldiacetate |
Angielska nazwa | Triethyleneglycoldiacetate;Triethylene glycol diacetate;ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
MF | C10H18O6 |
Masie cząsteczkowej | 234.2463 |
InChI | InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
Nr CAS | 111-21-7 |
EINECS | 203-846-0 |
Struktury molekularnej | |
Gęstość | 1.098g/cm3 |
Temperatura wrzenia | 286°C at 760 mmHg |
Współczynnik załamania | 1.432 |
Temperatura zapłonu | 125.2°C |
Ciśnienie pary | 0.00271mmHg at 25°C |
Bezpieczeństwo opis | S24/25##Avoid contact with skin and eyes.:; |
MSDS |