ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Methyl 2-octynoate |
|
Nazwa produktu: | Methyl 2-octynoate |
Angielska nazwa | Methyl 2-octynoate;Methyl heptine carbonate;2-Octynoic acid, methyl ester;FEMA No. 2729;Folione;Methyl 2-octinate;Methyl 2-octynate;Methyl hept-1-yne-1-carboxylate;Methyl pentylacetylenecarboxylate;Vert de violette, artificial;Methyl oct-2-ynoate |
MF | C9H14O2 |
Masie cząsteczkowej | 154.2063 |
InChI | InChI=1/C9H14O2/c1-3-4-5-6-7-8-9(10)11-2/h3-6H2,1-2H3 |
Nr CAS | 111-12-6;53073-28-2 |
EINECS | 203-836-6 |
Struktury molekularnej | |
Gęstość | 0.94g/cm3 |
Temperatura wrzenia | 218.5°C at 760 mmHg |
Współczynnik załamania | 1.443 |
Temperatura zapłonu | 88.9°C |
Ciśnienie pary | 0.125mmHg at 25°C |
Kody ryzyka | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |