Chemindex > 110-49-6
PL ▼
110-49-6 2-Methoxyethyl acetate |
|
| Nazwa produktu: | 2-Methoxyethyl acetate |
| Angielska nazwa | 2-Methoxyethyl acetate;Methyl Cellosolve?acetate;1-Acetoxy-2-methoxyethane;Ethylene glycol monomethyl ether acetate;Methyl Cellosolve(rg acetate;2-sulfanylethyl acetate |
| MF | C4H8O2S |
| Masie cząsteczkowej | 120.1701 |
| InChI | InChI=1/C4H8O2S/c1-4(5)6-2-3-7/h7H,2-3H2,1H3 |
| Nr CAS | 110-49-6 |
| EINECS | 203-772-9 |
| Struktury molekularnej |  |
| Gęstość | 1.072g/cm3 |
| Temperatura topnienia | -65℃ |
| Temperatura wrzenia | 162.7°C at 760 mmHg |
| Współczynnik załamania | 1.452 |
| Temperatura zapłonu | 57.6°C |
| Ciśnienie pary | 2.14mmHg at 25°C |
| Symbole zagrożenia |  T##Toxic:; |
| Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R60##May impair fertility.||R61##May cause harm to the unborn child.:; |
| Bezpieczeństwo opis | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
| MSDS | |
- Jeśli planujesz zaopatrywać się w chemikalia z Chin, po prostu udaj się do centrum handlowego ChemNet, a my uzyskamy dla Ciebie najnowszą i konkurencyjną cenę od chińskich producentów.Odwiedź stronę
ChemNet Mall
Usługa bazy danych Chemical CAS jest świadczona przez ChemIndex.com 