ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,4-Diethylbenzene |
|
Nazwa produktu: | 1,4-Diethylbenzene |
Angielska nazwa | 1,4-Diethylbenzene;Benzene, 1,4-diethyl-;Benzene, p-diethyl-;HSDB 4083;p-Diethylbenzene;p-Ethylethylbenzene;butan-2-ylbenzene;PDEB |
MF | C10H14 |
Masie cząsteczkowej | 134.2182 |
InChI | InChI=1/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
Nr CAS | 105-05-5 |
EINECS | 203-265-2 |
Struktury molekularnej | |
Gęstość | 0.86g/cm3 |
Temperatura topnienia | -43℃ |
Temperatura wrzenia | 173.3°C at 760 mmHg |
Współczynnik załamania | 1.489 |
Temperatura zapłonu | 46.3°C |
Ciśnienie pary | 1.7mmHg at 25°C |
Bezpieczeństwo opis | S24/25##Avoid contact with skin and eyes.:; |
MSDS |