ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
104-66-5 1,2-Diphenoxyethane |
|
Nazwa produktu: | 1,2-Diphenoxyethane |
Angielska nazwa | 1,2-Diphenoxyethane;Ethylene glycol diphenyl ether;1,1'-[ethane-1,2-diylbis(oxy)]dibenzene;1,2-Diphenoxy ethane |
MF | C14H14O2 |
Masie cząsteczkowej | 214.2598 |
InChI | InChI=1/C14H14O2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10H,11-12H2 |
Nr CAS | 104-66-5 |
EINECS | 203-224-9 |
Struktury molekularnej | ![]() |
Gęstość | 1.08g/cm3 |
Temperatura topnienia | 95-98℃ |
Temperatura wrzenia | 341.6°C at 760 mmHg |
Współczynnik załamania | 1.556 |
Temperatura zapłonu | 139.4°C |
Ciśnienie pary | 0.000158mmHg at 25°C |
Bezpieczeństwo opis | S24/25##Avoid contact with skin and eyes.:; |
MSDS |