ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102-38-5 3-Nitroformanilide |
|
Nazwa produktu: | 3-Nitroformanilide |
Angielska nazwa | 3-Nitroformanilide;N-(3-nitrophenyl)formamide |
MF | C7H6N2O3 |
Masie cząsteczkowej | 166.1341 |
InChI | InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
Nr CAS | 102-38-5 |
Struktury molekularnej | |
Gęstość | 1.407g/cm3 |
Temperatura wrzenia | 368.5°C at 760 mmHg |
Współczynnik załamania | 1.641 |
Temperatura zapłonu | 176.7°C |
Ciśnienie pary | 1.27E-05mmHg at 25°C |
Kody ryzyka | R20/22##Harmful by inhalation and if swallowed.:; |
Bezpieczeństwo opis | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |