ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101-99-5 N-Phenylurethane |
|
| Nazwa produktu: | N-Phenylurethane |
| Angielska nazwa | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
| MF | C9H11NO2 |
| Masie cząsteczkowej | 165.1891 |
| InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| Nr CAS | 101-99-5 |
| EINECS | 202-995-9 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.136g/cm3 |
| Temperatura wrzenia | 238°C at 760 mmHg |
| Współczynnik załamania | 1.558 |
| Temperatura zapłonu | 79.2°C |
| Ciśnienie pary | 0.0434mmHg at 25°C |
| Kody ryzyka | R40##Possible risks of irreversible effects.:; |
| Bezpieczeństwo opis | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |