ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101-99-5 N-Phenylurethane |
|
Nazwa produktu: | N-Phenylurethane |
Angielska nazwa | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
MF | C9H11NO2 |
Masie cząsteczkowej | 165.1891 |
InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
Nr CAS | 101-99-5 |
EINECS | 202-995-9 |
Struktury molekularnej | |
Gęstość | 1.136g/cm3 |
Temperatura wrzenia | 238°C at 760 mmHg |
Współczynnik załamania | 1.558 |
Temperatura zapłonu | 79.2°C |
Ciśnienie pary | 0.0434mmHg at 25°C |
Kody ryzyka | R40##Possible risks of irreversible effects.:; |
Bezpieczeństwo opis | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |