ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Methyl 4-hydroxy-3-nitrobenzoate |
|
produktnavn | Methyl 4-hydroxy-3-nitrobenzoate |
Engelsk navn | Methyl 4-hydroxy-3-nitrobenzoate;4-Hydroxy-3-nitrobenzoic acid methyl ester;Methyl 3-nitro-4-hydroxybenzoate;4-(methoxycarbonyl)-2-nitrophenolate;3-nitro-4-hydroxymethyl benzoate |
Molekylær Formel | C8H6NO5 |
Molekylvekt | 196.1375 |
InChI | InChI=1/C8H7NO5/c1-14-8(11)5-2-3-7(10)6(4-5)9(12)13/h2-4,10H,1H3/p-1 |
CAS-nummer | 99-42-3 |
EINECS | 202-755-3 |
Molecular Structure | |
Smeltepunkt | 74-76℃ |
Kokepunkt | 311.1°C at 760 mmHg |
Flammepunktet | 141.9°C |
Damptrykk | 0.000315mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |