Chemindex > 99-29-6
NO ▼
2-Bromo-6-chloro-4-nitroaniline |
|
| produktnavn | 2-Bromo-6-chloro-4-nitroaniline |
| Engelsk navn | 2-Bromo-6-chloro-4-nitroaniline;Benzenamine, 2-bromo-6-chloro-4-nitro-;NSC 88985;Aniline, 2-bromo-6-chloro-4-nitro-;2-Chloro-4-nitro-6-bromoaniline |
| Molekylær Formel | C6H4BrClN2O2 |
| Molekylvekt | 251.4652 |
| InChI | InChI=1/C6H4BrClN2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
| CAS-nummer | 99-29-6 |
| EINECS | 202-745-9 |
| Molecular Structure |  |
| Tetthet | 1.909g/cm3 |
| Kokepunkt | 344.7°C at 760 mmHg |
| Brytningsindeks | 1.677 |
| Flammepunktet | 162.3°C |
| Damptrykk | 6.47E-05mmHg at 25°C |
| Risiko Koder | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
| Sikkerhet Beskrivelse | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk ChemNet Mall for å spørre om prisen på
2-Bromo-6-chloro-4-nitroaniline 99-29-6
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 