ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98-81-7 alpha-bromostyrene |
|
produktnavn | alpha-bromostyrene |
Engelsk navn | alpha-bromostyrene;1-(1-Bromovinyl)benzene;(1-bromoethenyl)benzene |
Molekylær Formel | C8H7Br |
Molekylvekt | 183.0452 |
InChI | InChI=1/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
CAS-nummer | 98-81-7 |
EINECS | 202-702-4 |
Molecular Structure | ![]() |
Tetthet | 1.387g/cm3 |
Smeltepunkt | -44℃ |
Kokepunkt | 212.6°C at 760 mmHg |
Brytningsindeks | 1.574 |
Flammepunktet | 98.3°C |
Damptrykk | 0.249mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |