Chemindex > 97158-49-1
NO ▼
97158-49-1 benzotiazol-2(3H)-tiion, natriumsalt, forbindelse med 2-aminoetanol |
|
| produktnavn | benzotiazol-2(3H)-tiion, natriumsalt, forbindelse med 2-aminoetanol |
| Synonymer | Benzotiazol-2(3H)-tion, natriumsalt, forbindelse med 2-aminoetanol; natrium 2-aminoetanol 3H-1,3-benzotiazol-2-tion; |
| Engelsk navn | benzothiazole-2(3H)-thione, sodium salt, compound with 2-aminoethanol;Benzothiazole-2(3H)-thione, sodium salt, compound with 2-aminoethanol;sodium 2-aminoethanol 3H-1,3-benzothiazole-2-thione |
| Molekylær Formel | C9H12N2NaOS2 |
| Molekylvekt | 251.3236 |
| InChI | InChI=1/C7H5NS2.C2H7NO.Na/c9-7-8-5-3-1-2-4-6(5)10-7;3-1-2-4;/h1-4H,(H,8,9);4H,1-3H2;/q;;+1 |
| CAS-nummer | 97158-49-1 |
| EINECS | 306-379-1 |
| Molecular Structure |  |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 97158-49-1 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 