ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Ethyl-1-butanol |
|
produktnavn | 2-Ethyl-1-butanol |
Engelsk navn | 2-Ethyl-1-butanol;2-Ethylbutyl alcohol;2-ethylbutan-1-ol |
Molekylær Formel | C6H14O |
Molekylvekt | 102.1748 |
InChI | InChI=1/C6H14O/c1-3-6(4-2)5-7/h6-7H,3-5H2,1-2H3 |
CAS-nummer | 97-95-0 |
EINECS | 202-621-4 |
Molecular Structure | |
Tetthet | 0.814g/cm3 |
Smeltepunkt | -15℃ |
Kokepunkt | 146.5°C at 760 mmHg |
Brytningsindeks | 1.413 |
Flammepunktet | 58.3°C |
Damptrykk | 1.81mmHg at 25°C |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R21/22##Harmful in contact with skin and if swallowed.:; |
MSDS |