ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
96-20-8 (±)-2-Amino-1-butanol |
|
produktnavn | (±)-2-Amino-1-butanol |
Engelsk navn | (±)-2-Amino-1-butanol;(-)-2-Aminobutanol;.+/-.-2-Amino-1-butanol;1-butanol, 2-amino-;2-Aminobutan-1-ol;2-Amino-1-butanol;2-aminobutan-2-ol;2-Amino-1-butanol |
Molekylær Formel | C4H12NO |
Molekylvekt | 90.1436 |
InChI | InChI=1/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3/p+1/t4-/m1/s1 |
CAS-nummer | 96-20-8 |
EINECS | 202-488-2 |
Molecular Structure | |
Smeltepunkt | -2℃ |
Kokepunkt | 177.2°C at 760 mmHg |
Flammepunktet | 82.2°C |
Damptrykk | 0.319mmHg at 25°C |
Hazard symboler | C##Corrosive:; |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |