ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
95727-77-8 2,6-Difluorbutyrophenone |
|
produktnavn | 2,6-Difluorbutyrophenone |
Synonymer | 1-(2,6-difluorfenyl)butan-1-on; |
Engelsk navn | 2,6-Difluorobutyrophenone;1-(2,6-difluorophenyl)butan-1-one |
Molekylær Formel | C10H10F2O |
Molekylvekt | 184.1826 |
InChI | InChI=1/C10H10F2O/c1-2-4-9(13)10-7(11)5-3-6-8(10)12/h3,5-6H,2,4H2,1H3 |
CAS-nummer | 95727-77-8 |
Molecular Structure | |
Tetthet | 1.134g/cm3 |
Kokepunkt | 219.6°C at 760 mmHg |
Brytningsindeks | 1.472 |
Flammepunktet | 82.6°C |
Damptrykk | 0.118mmHg at 25°C |
Risiko Koder | R36/38##Irritating to eyes and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |