ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94088-47-8 2,6-Dibenzyloxybenzonitrile |
|
produktnavn | 2,6-Dibenzyloxybenzonitrile |
Engelsk navn | 2,6-Dibenzyloxybenzonitrile;2,6-Bis(phenylmethoxy)benzonitrile;2,6-bis(benzyloxy)benzonitrile |
Molekylær Formel | C21H17NO2 |
Molekylvekt | 315.3652 |
InChI | InChI=1/C21H17NO2/c22-14-19-20(23-15-17-8-3-1-4-9-17)12-7-13-21(19)24-16-18-10-5-2-6-11-18/h1-13H,15-16H2 |
CAS-nummer | 94088-47-8 |
EINECS | 302-048-0 |
Molecular Structure | |
Tetthet | 1.19g/cm3 |
Kokepunkt | 514.4°C at 760 mmHg |
Brytningsindeks | 1.625 |
Flammepunktet | 178.9°C |
Damptrykk | 1.08E-10mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |