ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94-96-2 2-Ethyl-1,3-hexanediol, mixture of isomers |
|
produktnavn | 2-Ethyl-1,3-hexanediol, mixture of isomers |
Engelsk navn | 2-Ethyl-1,3-hexanediol, mixture of isomers;Ethohexadiol;2-Ethylhexane-1,3-diol;octylene glycol;2-ethylhexane-1,1-diol;(2S,3S)-2-ethylhexane-1,3-diol;(2R,3S)-2-ethylhexane-1,3-diol;(2R,3R)-2-ethylhexane-1,3-diol;(2S,3R)-2-ethylhexane-1,3-diol;OG;2-Ethyl-1,3-Hexanediol |
Molekylær Formel | C8H18O2 |
Molekylvekt | 146.2273 |
InChI | InChI=1/C8H18O2/c1-3-5-8(10)7(4-2)6-9/h7-10H,3-6H2,1-2H3/t7-,8+/m0/s1 |
CAS-nummer | 94-96-2 |
EINECS | 202-377-9 |
Molecular Structure | |
Tetthet | 0.935g/cm3 |
Smeltepunkt | -40℃ |
Kokepunkt | 243°C at 760 mmHg |
Brytningsindeks | 1.45 |
Flammepunktet | 129.4°C |
Vannløselighet | 42 g/L (20℃) |
Damptrykk | 0.00558mmHg at 25°C |
Hazard symboler | Xi##Irritant:; |
Risiko Koder | R41:; |
Sikkerhet Beskrivelse | S25||S26||S39||S46:; |
MSDS |