ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94-46-2 isopentyl benzoate |
|
produktnavn | isopentyl benzoate |
Engelsk navn | isopentyl benzoate;Benzoic acid isoamyl ester;3-methyl-1-butanol benzoate;benzoic acid isopentyl ester;Isoamyl Benzoate;3-methylbutyl benzoate |
Molekylær Formel | C12H16O2 |
Molekylvekt | 192.2542 |
InChI | InChI=1/C12H16O2/c1-10(2)8-9-14-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
CAS-nummer | 94-46-2 |
EINECS | 202-334-4 |
Molecular Structure | ![]() |
Tetthet | 0.992g/cm3 |
Kokepunkt | 260°C at 760 mmHg |
Brytningsindeks | 1.495 |
Flammepunktet | 109.4°C |
Damptrykk | 0.0125mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |