ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
91-61-2 6-Methyl-1,2,3,4-tetrahydroquinoline |
|
produktnavn | 6-Methyl-1,2,3,4-tetrahydroquinoline |
Engelsk navn | 6-Methyl-1,2,3,4-tetrahydroquinoline;1,2,3,4-Tetrahydro-6-methylquinoline;AI3-36188;Civettal;NSC 65606;p-Methyltetrahydroquinoline;Quinoline, 1,2,3,4-tetrahydro-6-methyl- |
Molekylær Formel | C10H13N |
Molekylvekt | 147.2169 |
InChI | InChI=1/C10H13N/c1-8-4-5-10-9(7-8)3-2-6-11-10/h4-5,7,11H,2-3,6H2,1H3 |
CAS-nummer | 91-61-2 |
EINECS | 202-083-0 |
Molecular Structure | ![]() |
Tetthet | 0.99g/cm3 |
Kokepunkt | 264.2°C at 760 mmHg |
Brytningsindeks | 1.539 |
Flammepunktet | 119.1°C |
Damptrykk | 0.00982mmHg at 25°C |
Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Sikkerhet Beskrivelse | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |