ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
alpha-Phenylcinnamic acid |
|
produktnavn | alpha-Phenylcinnamic acid |
Engelsk navn | alpha-Phenylcinnamic acid;a-Phenyl-trans-cinnamic acid, Pract.;a-(Phenylmethylene)benzeneacetic acid, Pract.;Phenylcinnamicacid,98%;(2E)-2,3-diphenylprop-2-enoic acid;2,3-diphenylprop-2-enoic acid;(2Z)-2,3-diphenylprop-2-enoic acid;(2E)-2,3-diphenylprop-2-enoate;(2Z)-2,3-diphenylprop-2-enoate |
Molekylær Formel | C15H11O2 |
Molekylvekt | 223.2472 |
InChI | InChI=1/C15H12O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H,16,17)/p-1/b14-11- |
CAS-nummer | 91-48-5 |
EINECS | 202-069-4 |
Molecular Structure | |
Smeltepunkt | 171-175℃ |
Kokepunkt | 336.6°C at 760 mmHg |
Flammepunktet | 239.8°C |
Damptrykk | 4.35E-05mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |