ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
6,7-Bis(benzyloxy)kumarin |
|
produktnavn | 6,7-Bis(benzyloxy)kumarin |
Synonymer | ; Esculetin dibenzyl eter; 6,7-bis(benzyloxy)-2H-krom-2-on; |
Engelsk navn | 6,7-Bis(benzyloxy)coumarin;Esculetin dibenzyl ether;6,7-bis(benzyloxy)-2H-chromen-2-one |
Molekylær Formel | C23H18O4 |
Molekylvekt | 358.3866 |
InChI | InChI=1/C23H18O4/c24-23-12-11-19-13-21(25-15-17-7-3-1-4-8-17)22(14-20(19)27-23)26-16-18-9-5-2-6-10-18/h1-14H,15-16H2 |
CAS-nummer | 909-84-2 |
EINECS | 213-003-9 |
Molecular Structure | |
Tetthet | 1.25g/cm3 |
Kokepunkt | 560.2°C at 760 mmHg |
Brytningsindeks | 1.631 |
Flammepunktet | 246°C |
Damptrykk | 1.4E-12mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |