ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-49-6 Isopulegylacetat, blanding av isomerer |
|
produktnavn | Isopulegylacetat, blanding av isomerer |
Synonymer | ;(1R,2R,5R)-5-metyl-2-(1-metyletenyl)cykloheksylacetat; (1R,2R,5S)-5-metyl-2-(1-metyletenyl)cykloheksylacetat; (1R,2S,5S)-5-metyl-2-(1-metyletenyl)cykloheksylacetat; |
Engelsk navn | Isopulegyl acetate, mixture of isomers;(1R,2R,5R)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2R,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2S,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate |
Molekylær Formel | C12H20O2 |
Molekylvekt | 196.286 |
InChI | InChI=1/C12H20O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h9,11-12H,1,5-7H2,2-4H3/t9-,11-,12+/m0/s1 |
CAS-nummer | 89-49-6 |
Molecular Structure | |
Tetthet | 0.94g/cm3 |
Kokepunkt | 248°C at 760 mmHg |
Brytningsindeks | 1.458 |
Flammepunktet | 85.6°C |
Damptrykk | 0.0248mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |