ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-52-5 Gramine |
|
produktnavn | Gramine |
Engelsk navn | Gramine;3-(Dimethylaminomethyl)indole;(1H-Indol-3-ylmethyl)-dimethyl-amine |
Molekylær Formel | C11H14N2 |
Molekylvekt | 174.2423 |
InChI | InChI=1/C11H14N2/c1-13(2)8-9-7-12-11-6-4-3-5-10(9)11/h3-7,12H,8H2,1-2H3 |
CAS-nummer | 87-52-5 |
EINECS | 201-749-8 |
Molecular Structure | ![]() |
Tetthet | 1.099g/cm3 |
Smeltepunkt | 131-139℃ |
Kokepunkt | 293.9°C at 760 mmHg |
Brytningsindeks | 1.63 |
Flammepunktet | 131.5°C |
Vannløselighet | PRACTICALLY INSOLUBLE |
Damptrykk | 0.00168mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36##Irritating to eyes.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S46##If swallowed, seek medical advice immediately and show this container or label.:; |
MSDS |