ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-81-4 6-Methoxy-8-nitroquinoline |
|
produktnavn | 6-Methoxy-8-nitroquinoline |
Engelsk navn | 6-Methoxy-8-nitroquinoline;6-Methoxy-8-Nitro quinoline;methyl 8-nitro-6-quinolyl ether;6-Metoxy-8-nitroquinoline, 99% |
Molekylær Formel | C10H8N2O3 |
Molekylvekt | 204.1821 |
InChI | InChI=1/C10H8N2O3/c1-15-8-5-7-3-2-4-11-10(7)9(6-8)12(13)14/h2-6H,1H3 |
CAS-nummer | 85-81-4 |
EINECS | 201-633-7 |
Molecular Structure | ![]() |
Tetthet | 1.337g/cm3 |
Smeltepunkt | 158-162℃ |
Kokepunkt | 373.1°C at 760 mmHg |
Brytningsindeks | 1.646 |
Flammepunktet | 179.4°C |
Damptrykk | 1.97E-05mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |