Chemindex > 85-02-9
NO ▼
85-02-9 5,6-Benzoquinoline |
|
| produktnavn | 5,6-Benzoquinoline |
| Engelsk navn | 5,6-Benzoquinoline;beta-Naphthoquinoline;1-Azaphenanthrene;Benzo[f]quinoline;Benzoquinoline;benzo(f)quinoline |
| Molekylær Formel | C13H9N |
| Molekylvekt | 179.2173 |
| InChI | InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H |
| CAS-nummer | 85-02-9 |
| EINECS | 201-582-0 |
| Molecular Structure |  |
| Tetthet | 1.187g/cm3 |
| Smeltepunkt | 89-91℃ |
| Kokepunkt | 350.4°C at 760 mmHg |
| Brytningsindeks | 1.726 |
| Flammepunktet | 155.9°C |
| Damptrykk | 8.89E-05mmHg at 25°C |
| Hazard symboler |  Xn##Harmful:; |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.||R40##Possible risks of irreversible effects.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 