ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-60-6 2,6-Dihydroxyanthraquinone |
|
produktnavn | 2,6-Dihydroxyanthraquinone |
Engelsk navn | 2,6-Dihydroxyanthraquinone; |
Molekylær Formel | C14H8O4 |
Molekylvekt | 240.2109 |
InChI | InChI=1/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H |
CAS-nummer | 84-60-6 |
EINECS | 201-544-3 |
Molecular Structure | ![]() |
Tetthet | 1.54g/cm3 |
Smeltepunkt | 320℃ |
Kokepunkt | 442.1°C at 760 mmHg |
Brytningsindeks | 1.732 |
Flammepunktet | 235.3°C |
Damptrykk | 1.99E-08mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |