ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-30-7 2,4,6-Trihydroxybenzoic acid |
|
produktnavn | 2,4,6-Trihydroxybenzoic acid |
Engelsk navn | 2,4,6-Trihydroxybenzoic acid;Phloroglucinolcarboxylic acid;2,4,6-Trichydroxybenzoic acid;2,4,6-Trihydroxybenzene carboxylic acid;2,4,6-trihydroxy-benzoicaci;Benzoic acid, 2,4,6-trihydroxy-;Phloroglucincarboxylic acid;Phloroglucinic acid;phloroglucinicacid;RARECHEM AL BE 0039;2,4,6-trihydrobenzoic acid |
Molekylær Formel | C7H6O5 |
Molekylvekt | 170.1195 |
InChI | InChI=1/C7H6O5/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,8-10H,(H,11,12) |
CAS-nummer | 83-30-7 |
EINECS | 201-467-5 |
Molecular Structure | |
Tetthet | 1.749g/cm3 |
Smeltepunkt | 210℃ |
Kokepunkt | 426.5°C at 760 mmHg |
Brytningsindeks | 1.73 |
Flammepunktet | 225.9°C |
Damptrykk | 4.93E-08mmHg at 25°C |
Hazard symboler | Xi:; |
Risiko Koder | 36/37/38:; |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |