ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Thianaphthene-1,1-dioxide |
|
produktnavn | Thianaphthene-1,1-dioxide |
Engelsk navn | Thianaphthene-1,1-dioxide;Thianaphthene 1,1-dioxide;Benzo[b]thiophene 1,1-dioxide;1-benzothiophene 1,1-dioxide |
Molekylær Formel | C8H6O2S |
Molekylvekt | 166.197 |
InChI | InChI=1/C8H6O2S/c9-11(10)6-5-7-3-1-2-4-8(7)11/h1-6H |
CAS-nummer | 825-44-5 |
EINECS | 212-544-8 |
Molecular Structure | |
Tetthet | 1.403g/cm3 |
Smeltepunkt | 137-138℃ |
Kokepunkt | 371.1°C at 760 mmHg |
Brytningsindeks | 1.64 |
Flammepunktet | 244°C |
Damptrykk | 2.25E-05mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |