Chemindex > 824-62-4
NO ▼
824-62-4 Bicyclo[2.2.1]heptane-2-carboxylic Acid |
|
| produktnavn | Bicyclo[2.2.1]heptane-2-carboxylic Acid |
| Engelsk navn | Bicyclo[2.2.1]heptane-2-carboxylic Acid;Norbornane-2-carboxylic acid;(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate;(1S,2S,4R)-bicyclo[2.2.1]heptane-2-carboxylate |
| Molekylær Formel | C8H11O2 |
| Molekylvekt | 139.1723 |
| InChI | InChI=1/C8H12O2/c9-8(10)7-4-5-1-2-6(7)3-5/h5-7H,1-4H2,(H,9,10)/p-1/t5-,6+,7+/m1/s1 |
| CAS-nummer | 824-62-4 |
| EINECS | 212-532-2 |
| Molecular Structure | ![824-62-4 Bicyclo[2.2.1]heptane-2-carboxylic Acid](https://images-a.chemnet.com/suppliers/chembase/cas/cas824-62-4.gif "824-62-4 Bicyclo[2.2.1]heptane-2-carboxylic Acid") |
| Kokepunkt | 247.822°C at 760 mmHg |
| Flammepunktet | 113.81°C |
| Damptrykk | 0.008mmHg at 25°C |
| Risiko Koder | R36/38##Irritating to eyes and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 