ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-(chloromethyl)-2,4-dimethylbenzene |
|
produktnavn | 1-(chloromethyl)-2,4-dimethylbenzene |
Engelsk navn | 1-(chloromethyl)-2,4-dimethylbenzene;2,4-Dimethylbenzyl chloride;4-(Chloromethyl)-m-xylene;2,4-Dimethylbenzylchloride |
Molekylær Formel | C9H11Cl |
Molekylvekt | 154.6366 |
InChI | InChI=1/C9H11Cl/c1-7-3-4-9(6-10)8(2)5-7/h3-5H,6H2,1-2H3 |
CAS-nummer | 824-55-5 |
EINECS | 212-531-7 |
Molecular Structure | |
Tetthet | 1.033g/cm3 |
Kokepunkt | 215.5°C at 760 mmHg |
Brytningsindeks | 1.522 |
Flammepunktet | 86.5°C |
Damptrykk | 0.216mmHg at 25°C |
Hazard symboler | C##Corrosive:; |
Risiko Koder | R34##Causes burns.||R36##Irritating to eyes.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |