ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
824-46-4 2-Methoxyhydroquinone |
|
produktnavn | 2-Methoxyhydroquinone |
Engelsk navn | 2-Methoxyhydroquinone;2,5-Dihydroxyanisole;2-methoxyquinol;2-methoxybenzene-1,4-diol;Methoxy hydroquinone |
Molekylær Formel | C7H8O3 |
Molekylvekt | 140.1366 |
InChI | InChI=1/C7H8O3/c1-10-7-4-5(8)2-3-6(7)9/h2-4,8-9H,1H3 |
CAS-nummer | 824-46-4 |
EINECS | 212-530-1 |
Molecular Structure | |
Tetthet | 1.27g/cm3 |
Smeltepunkt | 89-91℃ |
Kokepunkt | 311.3°C at 760 mmHg |
Brytningsindeks | 1.579 |
Flammepunktet | 142.1°C |
Damptrykk | 0.000311mmHg at 25°C |
Hazard symboler | Xi##Irritant:; |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S22||S24/25:; |
MSDS |