ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,5-Dichloroanthraquinone |
|
produktnavn | 1,5-Dichloroanthraquinone |
Engelsk navn | 1,5-Dichloroanthraquinone;1,5-Dichloranthrachinon;1,5-Dichloranthrachinon [Czech];1,5-Dichloro-9,10-anthraquinone;9,10-Anthracenedione, 1,5-dichloro-;AI3-38301;NSC 13969;Anthraquinone, 1,5-dichloro-;1,5-dichloroanthracene-9,10-dione;1,5-Dichloro Anthraquinone |
Molekylær Formel | C14H6Cl2O2 |
Molekylvekt | 277.1022 |
InChI | InChI=1/C14H6Cl2O2/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6H |
CAS-nummer | 82-46-2 |
EINECS | 201-424-0 |
Molecular Structure | |
Tetthet | 1.514g/cm3 |
Smeltepunkt | 245-250℃ |
Kokepunkt | 455.2°C at 760 mmHg |
Brytningsindeks | 1.671 |
Flammepunktet | 191.7°C |
Damptrykk | 1.79E-08mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |