ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
mono-methyl sebacate |
|
produktnavn | mono-methyl sebacate |
Engelsk navn | mono-methyl sebacate;Monomethyl sebacate~Sebacic acid monomethyl ester;Sebacic acid monomethyl ester;Methyl hydrogen sebacate (Monomethyl sebacate; Sebacic acid monomethyl ester);monomethyl sebacate;10-methoxy-10-oxodecanoic acid |
Molekylær Formel | C11H20O4 |
Molekylvekt | 216.2741 |
InChI | InChI=1/C11H20O4/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
CAS-nummer | 818-88-2 |
EINECS | 212-458-0 |
Molecular Structure | |
Tetthet | 1.038g/cm3 |
Smeltepunkt | 41-44℃ |
Kokepunkt | 332.5°C at 760 mmHg |
Brytningsindeks | 1.453 |
Flammepunktet | 115.4°C |
Damptrykk | 2.8E-05mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |