ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
818-38-2 diethyl glutarate |
|
produktnavn | diethyl glutarate |
Engelsk navn | diethyl glutarate;Diethyl glutarate, (Glutaric acid diethyl ester);Glutaric acid diethyl ester;Diethyl Pentanediate;diethyl pentanedioate |
Molekylær Formel | C9H16O4 |
Molekylvekt | 188.2209 |
InChI | InChI=1/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
CAS-nummer | 818-38-2 |
EINECS | 212-451-2 |
Molecular Structure | ![]() |
Tetthet | 1.022g/cm3 |
Kokepunkt | 236.5°C at 760 mmHg |
Brytningsindeks | 1.427 |
Flammepunktet | 96.1°C |
Damptrykk | 0.0472mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |