ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
813-56-9 Malonic-d2 syre-d2 |
|
produktnavn | Malonic-d2 syre-d2 |
Synonymer | ; Malonsyre-d4; (~2~H_2_)propan (~2~H_2_)diosyre; |
Engelsk navn | Malonic-d2 acid-d2;Malonic acid-d4;(~2~H_2_)propane(~2~H_2_)dioic acid |
Molekylær Formel | C3D4O4 |
Molekylvekt | 108.0861 |
InChI | InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
CAS-nummer | 813-56-9 |
EINECS | 212-385-4 |
Molecular Structure | |
Tetthet | 1.605g/cm3 |
Smeltepunkt | 130-132℃ |
Kokepunkt | 386.8°C at 760 mmHg |
Brytningsindeks | 1.478 |
Flammepunktet | 201.9°C |
Damptrykk | 4.66E-07mmHg at 25°C |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |