ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Hydroxynitroanthraquinone; 97% |
|
produktnavn | Hydroxynitroanthraquinone; 97% |
Engelsk navn | Hydroxynitroanthraquinone; 97%;1-Hydroxy-4-nitroanthraquinone;1-Hydroxy-4-nitro-9,10-dihydroanthracene-9,10-dione;1-hydroxy-4-nitroanthracene-9,10-dione |
Molekylær Formel | C14H7NO5 |
Molekylvekt | 269.2091 |
InChI | InChI=1/C14H7NO5/c16-10-6-5-9(15(19)20)11-12(10)14(18)8-4-2-1-3-7(8)13(11)17/h1-6,16H |
CAS-nummer | 81-65-2 |
Molecular Structure | |
Tetthet | 1.589g/cm3 |
Smeltepunkt | 273℃ |
Kokepunkt | 524.3°C at 760 mmHg |
Brytningsindeks | 1.723 |
Flammepunktet | 225.9°C |
Damptrykk | 1.31E-11mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |