ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77-04-3 Pyrithyldione |
|
produktnavn | Pyrithyldione |
Engelsk navn | Pyrithyldione;3,3-Diethyl-2,4(1H,3H)-pyridinedione;3,3-diethylpyridine-2,4(1H,3H)-dione |
Molekylær Formel | C9H13NO2 |
Molekylvekt | 167.205 |
InChI | InChI=1/C9H13NO2/c1-3-9(4-2)7(11)5-6-10-8(9)12/h5-6H,3-4H2,1-2H3,(H,10,12) |
CAS-nummer | 77-04-3 |
EINECS | 201-000-5 |
Molecular Structure | |
Tetthet | 1.029g/cm3 |
Kokepunkt | 330.2°C at 760 mmHg |
Brytningsindeks | 1.464 |
Flammepunktet | 147.8°C |
Damptrykk | 0.000169mmHg at 25°C |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R20/21##Harmful by inhalation and in contact with skin.:; |
Sikkerhet Beskrivelse | S23##Do not inhale gas/fumes/vapour/spray.:; |
MSDS |