ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2',7'-Dichlorofluorescein |
|
produktnavn | 2',7'-Dichlorofluorescein |
Engelsk navn | 2',7'-Dichlorofluorescein; |
Molekylær Formel | C20H10Cl2O5 |
Molekylvekt | 401.1964 |
InChI | InChI=1/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)27-18-8-16(24)14(22)6-12(18)19(11)9-3-1-2-4-10(9)20(25)26/h1-8,23H,(H,25,26) |
CAS-nummer | 76-54-0 |
EINECS | 200-968-6 |
Molecular Structure | |
Tetthet | 1.68g/cm3 |
Smeltepunkt | 280℃ |
Kokepunkt | 670.7°C at 760 mmHg |
Brytningsindeks | 1.757 |
Flammepunktet | 359.4°C |
Damptrykk | 6.63E-19mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |