ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75-27-4 Bromodichloromethane |
|
produktnavn | Bromodichloromethane |
Engelsk navn | Bromodichloromethane;FC-20B1 |
Molekylær Formel | CHBrCl2 |
Molekylvekt | 163.8286 |
InChI | InChI=1/CHBrCl2/c2-1(3)4/h1H |
CAS-nummer | 75-27-4 |
EINECS | 200-856-7 |
Molecular Structure | |
Tetthet | 2.013g/cm3 |
Smeltepunkt | -55℃ |
Kokepunkt | 89.7°C at 760 mmHg |
Brytningsindeks | 1.503 |
Flammepunktet | 1.3°C |
Damptrykk | 65.3mmHg at 25°C |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
Sikkerhet Beskrivelse | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |