ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72856-73-6 2-methoxy-4-(methylthio)benzoic acid |
|
produktnavn | 2-methoxy-4-(methylthio)benzoic acid |
Engelsk navn | 2-methoxy-4-(methylthio)benzoic acid;4-(Methylthio)-o-anisic acid;2-methoxy-4-(methylsulfanyl)benzoic acid |
Molekylær Formel | C9H10O3S |
Molekylvekt | 198.2389 |
InChI | InChI=1/C9H10O3S/c1-12-8-5-6(13-2)3-4-7(8)9(10)11/h3-5H,1-2H3,(H,10,11) |
CAS-nummer | 72856-73-6 |
EINECS | 276-948-6 |
Molecular Structure | |
Tetthet | 1.29g/cm3 |
Kokepunkt | 342.3°C at 760 mmHg |
Brytningsindeks | 1.592 |
Flammepunktet | 160.8°C |
Damptrykk | 2.92E-05mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |