ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4,4'-Dimethoxybenzhydrol |
|
produktnavn | 4,4'-Dimethoxybenzhydrol |
Engelsk navn | 4,4'-Dimethoxybenzhydrol;Bis(4-methoxyphenyl) carbinol;4,4-Dimethoxydiphenylmethanol;4,4-Dimethoxybenzhydrol;Bis(4-methoxyphenyl)carbinol;bis(4-methoxyphenyl)methanol |
Molekylær Formel | C15H16O3 |
Molekylvekt | 244.2857 |
InChI | InChI=1/C15H16O3/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10,15-16H,1-2H3 |
CAS-nummer | 728-87-0 |
EINECS | 211-975-9 |
Molecular Structure | |
Tetthet | 1.135g/cm3 |
Smeltepunkt | 68-72℃ |
Kokepunkt | 406.5°C at 760 mmHg |
Brytningsindeks | 1.568 |
Flammepunktet | 199.6°C |
Damptrykk | 2.46E-07mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |