ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Methoxybenzhydrol |
|
produktnavn | 4-Methoxybenzhydrol |
Engelsk navn | 4-Methoxybenzhydrol;4-Methoxydiphenylmethanol~4-Methoxyphenyl phenyl carbinol;(4-methoxyphenyl)(phenyl)methanol |
Molekylær Formel | C14H14O2 |
Molekylvekt | 214.2598 |
InChI | InChI=1/C14H14O2/c1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11/h2-10,14-15H,1H3 |
CAS-nummer | 720-44-5 |
EINECS | 211-953-9 |
Molecular Structure | |
Tetthet | 1.121g/cm3 |
Kokepunkt | 363.2°C at 760 mmHg |
Brytningsindeks | 1.582 |
Flammepunktet | 164.5°C |
Damptrykk | 6.55E-06mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |