ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
|
produktnavn | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
Engelsk navn | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane; |
Molekylær Formel | C14H10Cl4 |
Molekylvekt | 320.04 |
InChI | InChI=1/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
CAS-nummer | 72-54-8 |
EINECS | 200-783-0 |
Molecular Structure | |
Smeltepunkt | 109-111℃ |
Hazard symboler | T##Toxic:; |
Risiko Koder | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
Sikkerhet Beskrivelse | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |