ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
719-54-0 10-Methyl-9(10H)-acridone |
|
produktnavn | 10-Methyl-9(10H)-acridone |
Engelsk navn | 10-Methyl-9(10H)-acridone;10-methylacridin-9(10H)-one;Methylacridone;N-Methylacridone |
Molekylær Formel | C14H11NO |
Molekylvekt | 209.2432 |
InChI | InChI=1/C14H11NO/c1-15-12-8-4-2-6-10(12)14(16)11-7-3-5-9-13(11)15/h2-9H,1H3 |
CAS-nummer | 719-54-0 |
EINECS | 211-948-1 |
Molecular Structure | |
Tetthet | 1.205g/cm3 |
Smeltepunkt | 204-207℃ |
Kokepunkt | 361.3°C at 760 mmHg |
Brytningsindeks | 1.635 |
Flammepunktet | 146.2°C |
Damptrykk | 2.09E-05mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |