ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
6-Nitropiperonal |
|
produktnavn | 6-Nitropiperonal |
Engelsk navn | 6-Nitropiperonal;(3,4-Methylenedioxy-6-nitrobenzald;4,5-Methylenedioxy-2-nitrobenzaldehyde;6-Nitro-1,3-benzodioxole-5-carboxaldehyde;6-nitro-1,3-benzodioxole-5-carbaldehyde;4,5-(Methylenedioxy)-2-nitrobenzaldehyde |
Molekylær Formel | C8H5NO5 |
Molekylvekt | 195.129 |
InChI | InChI=1/C8H5NO5/c10-3-5-1-7-8(14-4-13-7)2-6(5)9(11)12/h1-3H,4H2 |
CAS-nummer | 712-97-0 |
EINECS | 211-926-1 |
Molecular Structure | |
Tetthet | 1.572g/cm3 |
Smeltepunkt | 93-96℃ |
Kokepunkt | 365.9°C at 760 mmHg |
Brytningsindeks | 1.658 |
Flammepunktet | 195°C |
Damptrykk | 1.52E-05mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |