ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Acetyl-1-naphthol |
|
produktnavn | 2-Acetyl-1-naphthol |
Engelsk navn | 2-Acetyl-1-naphthol;1-Hydroxy-2-acetonaphthone;2-Acetyl-1-hydroxynaphthalene |
Molekylær Formel | C12H10O2 |
Molekylvekt | 186.2066 |
InChI | InChI=1/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 |
CAS-nummer | 711-79-5 |
EINECS | 211-918-8 |
Molecular Structure | |
Tetthet | 1.213g/cm3 |
Smeltepunkt | 97-100℃ |
Kokepunkt | 334.9°C at 760 mmHg |
Brytningsindeks | 1.65 |
Flammepunktet | 142.4°C |
Damptrykk | 6.37E-05mmHg at 25°C |
Hazard symboler | Xi##Irritant:; |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |