ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
704-38-1 Bis(2-thienyl) ketone |
|
produktnavn | Bis(2-thienyl) ketone |
Engelsk navn | Bis(2-thienyl) ketone;Di-2-thienyl ketone;Bis(2-thienyl)ketone~Di-2-thienyl ketone;dithiophen-2-ylmethanone |
Molekylær Formel | C9H6OS2 |
Molekylvekt | 194.2733 |
InChI | InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
CAS-nummer | 704-38-1 |
Molecular Structure | |
Tetthet | 1.326g/cm3 |
Smeltepunkt | 89-91℃ |
Kokepunkt | 323°C at 760 mmHg |
Brytningsindeks | 1.64 |
Flammepunktet | 149.1°C |
Damptrykk | 0.00027mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |