ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
703-59-3 Homophthalic anhydride |
|
produktnavn | Homophthalic anhydride |
Engelsk navn | Homophthalic anhydride;1,3-Isochromandione;benzoglutaric anhydride;1H-isochromene-1,3(4H)-dione;o-Carboxyphenylacetic acid cyclic anhydride~1,3-Isochromanedione |
Molekylær Formel | C9H6O3 |
Molekylvekt | 162.1421 |
InChI | InChI=1/C9H6O3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-4H,5H2 |
CAS-nummer | 703-59-3 |
EINECS | 211-873-4 |
Molecular Structure | |
Tetthet | 1.347g/cm3 |
Smeltepunkt | 140-144℃ |
Kokepunkt | 324.5°C at 760 mmHg |
Brytningsindeks | 1.584 |
Flammepunktet | 159°C |
Damptrykk | 0.000244mmHg at 25°C |
Hazard symboler | Xi##Irritant:; |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |