ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
703-23-1 2-Hydroxy-6-methoxyacetophenone |
|
produktnavn | 2-Hydroxy-6-methoxyacetophenone |
Engelsk navn | 2-Hydroxy-6-methoxyacetophenone;1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one;1-(2-hydroxy-6-methoxyphenyl)ethanone;2'-Hydroxy-6'-methoxyacetophenone |
Molekylær Formel | C9H10O3 |
Molekylvekt | 166.1739 |
InChI | InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
CAS-nummer | 703-23-1 |
EINECS | 211-872-9 |
Molecular Structure | ![]() |
Tetthet | 1.158g/cm3 |
Smeltepunkt | 58-60℃ |
Kokepunkt | 259.5°C at 760 mmHg |
Brytningsindeks | 1.537 |
Flammepunktet | 108.1°C |
Damptrykk | 0.00798mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |